Products 102494-89-3
CAS 102494-89-3 appears in our catalog under these names: N1-(2-Nitrobenzyl)ethane-1,2-diamine dihydrochloride, 95%, N1-(2-Nitrobenzyl)ethane-1,2-diamine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;dihydrochloride (CAS 102494-89-3) is a chemical compound with the molecular formula C9H15Cl2N3O2 and a molecular weight of 268.14 g/mol. IUPAC name: N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;dihydrochloride. InChIKey: MTCUVYRXCYLJPP-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3O2 |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;dihydrochloride |
| InChIKey | MTCUVYRXCYLJPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCCN)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)