CAS 2241594-29-4 appears in our catalog under these names: METHYL (S)-2-AMINO-3-(6-AMINOPYRIDIN-3-YL)PROPANOATE 2HCL, 95%, Methyl (s)-2-amino-3-(6-aminopyridin-3-yl)propanoate dihydrochloride, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg.
Methyl (2S)-2-amino-3-(6-amino-3-pyridinyl)propanoate;dihydrochloride (CAS 2241594-29-4) is a chemical compound with the molecular formula C9H15Cl2N3O2 and a molecular weight of 268.14 g/mol. IUPAC name: methyl (2S)-2-amino-3-(6-amino-3-pyridinyl)propanoate;dihydrochloride. InChIKey: GFYRUCPIVRIUTC-KLXURFKVSA-N.
| Molecular formula | C9H15Cl2N3O2 |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(6-amino-3-pyridinyl)propanoate;dihydrochloride |
| InChIKey | GFYRUCPIVRIUTC-KLXURFKVSA-N |
| SMILES | COC(=O)[C@H](CC1=CN=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)