CAS 1025054-82-3 appears in our catalog under these names: 1,2-Dihydro-3-methyl-1-oxo-7-(trifluoromethyl)pyrrolo[1,2-a]pyrazine, 95%, 3-Methyl-7-(trifluoromethyl)pyrrolo(1,2-a)pyrazin-1(2H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-methyl-7-(trifluoromethyl)-2H-pyrrolo[1,2-a]pyrazin-1-one (CAS 1025054-82-3) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: 3-methyl-7-(trifluoromethyl)-2H-pyrrolo[1,2-a]pyrazin-1-one. InChIKey: DYHQRCYZMPRXNH-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 3-methyl-7-(trifluoromethyl)-2H-pyrrolo[1,2-a]pyrazin-1-one |
| InChIKey | DYHQRCYZMPRXNH-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C=C2C(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)