Products 428842-24-4
CAS 428842-24-4 is the registry number for (3E)-1,1,1-Trifluoro-4-[(pyridin-3-yl)amino]but-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-1,1,1-trifluoro-4-(pyridin-3-ylamino)but-3-en-2-one (CAS 428842-24-4) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: (E)-1,1,1-trifluoro-4-(pyridin-3-ylamino)but-3-en-2-one. InChIKey: LKKNTTDSIMZFIG-HWKANZROSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | (E)-1,1,1-trifluoro-4-(pyridin-3-ylamino)but-3-en-2-one |
| InChIKey | LKKNTTDSIMZFIG-HWKANZROSA-N |
| SMILES | C1=CC(=CN=C1)N/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)