Products 1025058-89-2
CAS 1025058-89-2 is the registry number for 2-[(2-Chlorobenzoyl)amino]-4-(methylsulfonyl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2-chlorobenzoyl)amino]-4-methylsulfonylbutanoic acid (CAS 1025058-89-2) is a chemical compound with the molecular formula C12H14ClNO5S and a molecular weight of 319.76 g/mol. IUPAC name: 2-[(2-chlorobenzoyl)amino]-4-methylsulfonylbutanoic acid. InChIKey: NGFNQJSTFVSYTG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO5S |
|---|---|
| Molecular weight | 319.76 g/mol |
| IUPAC name | 2-[(2-chlorobenzoyl)amino]-4-methylsulfonylbutanoic acid |
| InChIKey | NGFNQJSTFVSYTG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCC(C(=O)O)NC(=O)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)