Products 352668-16-7
CAS 352668-16-7 is the registry number for methyl 4-chloro-3-(morpholine-4-sulfonyl)benzoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate (CAS 352668-16-7) is a chemical compound with the molecular formula C12H14ClNO5S and a molecular weight of 319.76 g/mol. IUPAC name: methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate. InChIKey: BBUJYJLXXUEWEX-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO5S |
|---|---|
| Molecular weight | 319.76 g/mol |
| IUPAC name | methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| InChIKey | BBUJYJLXXUEWEX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)N2CCOCC2 |
Computed by PubChem (NCBI)