Products 1025143-31-0
CAS 1025143-31-0 is the registry number for 3-(4-(dimethylamino)phenyl)-2-((tert-butyl)sulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 100mg.
(Z)-2-tert-butylsulfonyl-3-[4-(dimethylamino)phenyl]prop-2-enenitrile (CAS 1025143-31-0) is a chemical compound with the molecular formula C15H20N2O2S and a molecular weight of 292.4 g/mol. IUPAC name: (Z)-2-tert-butylsulfonyl-3-[4-(dimethylamino)phenyl]prop-2-enenitrile. InChIKey: HTNSZDDYEJYYLA-UVTDQMKNSA-N.
| Molecular formula | C15H20N2O2S |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (Z)-2-tert-butylsulfonyl-3-[4-(dimethylamino)phenyl]prop-2-enenitrile |
| InChIKey | HTNSZDDYEJYYLA-UVTDQMKNSA-N |
| SMILES | CC(C)(C)S(=O)(=O)/C(=C\C1=CC=C(C=C1)N(C)C)/C#N |
Computed by PubChem (NCBI)