CAS 120164-19-4 is the registry number for 2-Amino-4,5,7-trimethylbenzo[d]thiazol-6-yl pivalate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-amino-4,5,7-trimethyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate (CAS 120164-19-4) is a chemical compound with the molecular formula C15H20N2O2S and a molecular weight of 292.4 g/mol. IUPAC name: (2-amino-4,5,7-trimethyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate. InChIKey: JRYCEPJHJLGFHA-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2S |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (2-amino-4,5,7-trimethyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate |
| InChIKey | JRYCEPJHJLGFHA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1N=C(S2)N)C)OC(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)