Products 1025148-36-0
CAS 1025148-36-0 is the registry number for ethyl 3-(4-(5-chloro-2-methylphenyl)piperazinyl)-2-cyanoprop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (Z)-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-cyanoprop-2-enoate (CAS 1025148-36-0) is a chemical compound with the molecular formula C17H20ClN3O2 and a molecular weight of 333.8 g/mol. IUPAC name: ethyl (Z)-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-cyanoprop-2-enoate. InChIKey: BIENBBGGXZBZMV-OWBHPGMISA-N.
| Molecular formula | C17H20ClN3O2 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | ethyl (Z)-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-cyanoprop-2-enoate |
| InChIKey | BIENBBGGXZBZMV-OWBHPGMISA-N |
| SMILES | CCOC(=O)/C(=C\N1CCN(CC1)C2=C(C=CC(=C2)Cl)C)/C#N |
Computed by PubChem (NCBI)