CAS 225240-86-8 appears in our catalog under these names: CP-409092 HCl, 98%, CP–409092 hydrochloride, CP-409092 (hydrochloride), 99.72%, 99.72%, CP-409092 (hydrochloride), 99.79%, CP-409092 (hydrochloride) (Standard). Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 1mg, 10mM/1mL, 25 mg, 100 mg.
N-[4-(methylaminomethyl)phenyl]-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide;hydrochloride (CAS 225240-86-8) is a chemical compound with the molecular formula C17H20ClN3O2 and a molecular weight of 333.8 g/mol. IUPAC name: N-[4-(methylaminomethyl)phenyl]-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide;hydrochloride. InChIKey: XUBYQTCAOAXNKQ-UHFFFAOYSA-N.
| Molecular formula | C17H20ClN3O2 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | N-[4-(methylaminomethyl)phenyl]-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide;hydrochloride |
| InChIKey | XUBYQTCAOAXNKQ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=C(C=C1)NC(=O)C2=CNC3=C2C(=O)CCC3.Cl |
Computed by PubChem (NCBI)