Products 1025162-94-0
CAS 1025162-94-0 is the registry number for N-(4-chlorophenyl)-3-(4-phenylpiperazinyl)but-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-N-(4-chlorophenyl)-3-(4-phenylpiperazin-1-yl)but-2-enamide (CAS 1025162-94-0) is a chemical compound with the molecular formula C20H22ClN3O and a molecular weight of 355.9 g/mol. IUPAC name: (E)-N-(4-chlorophenyl)-3-(4-phenylpiperazin-1-yl)but-2-enamide. InChIKey: VARYDMUNFODDJZ-FOCLMDBBSA-N.
| Molecular formula | C20H22ClN3O |
|---|---|
| Molecular weight | 355.9 g/mol |
| IUPAC name | (E)-N-(4-chlorophenyl)-3-(4-phenylpiperazin-1-yl)but-2-enamide |
| InChIKey | VARYDMUNFODDJZ-FOCLMDBBSA-N |
| SMILES | C/C(=C\C(=O)NC1=CC=C(C=C1)Cl)/N2CCN(CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)