CAS 1189449-70-4 appears in our catalog under these names: Amodiaquine-d10, Amodiaquine-d10, >95% (HPLC), Amodiaquine–d10, Amodiaquine-d10, 97.0%, Amodiaquine-d10, min. 95 %, 1 mg. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 1 mg.
2-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-[(7-chloroquinolin-4-yl)amino]phenol (CAS 1189449-70-4) is a chemical compound with the molecular formula C20H22ClN3O and a molecular weight of 365.9 g/mol. IUPAC name: 2-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-[(7-chloroquinolin-4-yl)amino]phenol. InChIKey: OVCDSSHSILBFBN-MWUKXHIBSA-N.
| Molecular formula | C20H22ClN3O |
|---|---|
| Molecular weight | 365.9 g/mol |
| IUPAC name | 2-[[bis(1,1,2,2,2-pentadeuterioethyl)amino]methyl]-4-[(7-chloroquinolin-4-yl)amino]phenol |
| InChIKey | OVCDSSHSILBFBN-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O)C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)