Products 1025205-49-5
CAS 1025205-49-5 is the registry number for N-(2-indol-3-ylethyl)-3-(3-nitrophenyl)prop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitrophenyl)prop-2-enamide (CAS 1025205-49-5) is a chemical compound with the molecular formula C19H17N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitrophenyl)prop-2-enamide. InChIKey: AVOSVUCIXYAHLR-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitrophenyl)prop-2-enamide |
| InChIKey | AVOSVUCIXYAHLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C=CC3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)