CAS 1025221-24-2 is the registry number for aza(3-(4-bromophenyl)-7-methyl(6,7,8-trihydrocinnolin-5-ylidene))methoxymethane. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-bromophenyl)-N-methoxy-7-methyl-7,8-dihydro-6H-cinnolin-5-imine (CAS 1025221-24-2) is a chemical compound with the molecular formula C16H16BrN3O and a molecular weight of 346.22 g/mol. IUPAC name: 3-(4-bromophenyl)-N-methoxy-7-methyl-7,8-dihydro-6H-cinnolin-5-imine. InChIKey: NQKXIUCEXZBZGY-UHFFFAOYSA-N.
| Molecular formula | C16H16BrN3O |
|---|---|
| Molecular weight | 346.22 g/mol |
| IUPAC name | 3-(4-bromophenyl)-N-methoxy-7-methyl-7,8-dihydro-6H-cinnolin-5-imine |
| InChIKey | NQKXIUCEXZBZGY-UHFFFAOYSA-N |
| SMILES | CC1CC2=NN=C(C=C2C(=NOC)C1)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)