CAS 1025250-82-1 is the registry number for 6,8-dichloro-4H-chromen-4-one-3-carboxaldehyde thiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
[(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]thiourea (CAS 1025250-82-1) is a chemical compound with the molecular formula C11H7Cl2N3O2S and a molecular weight of 316.2 g/mol. IUPAC name: [(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]thiourea. InChIKey: NYFRVIVYZZQZES-CRKCGEKBSA-N.
| Molecular formula | C11H7Cl2N3O2S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | [(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]thiourea |
| InChIKey | NYFRVIVYZZQZES-CRKCGEKBSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CO2)/C=N/NC(=S)N)Cl)Cl |
Computed by PubChem (NCBI)