CAS 2055376-12-8 is the registry number for 3-(2,5-Dichloropyrimidin-4-yl)-2,3-dihydrobenzo[d]thiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-dichloropyrimidin-4-yl)-2H-1,3-benzothiazole 1,1-dioxide (CAS 2055376-12-8) is a chemical compound with the molecular formula C11H7Cl2N3O2S and a molecular weight of 316.2 g/mol. IUPAC name: 3-(2,5-dichloropyrimidin-4-yl)-2H-1,3-benzothiazole 1,1-dioxide. InChIKey: CFVLLBWIPYZDIQ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3O2S |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 3-(2,5-dichloropyrimidin-4-yl)-2H-1,3-benzothiazole 1,1-dioxide |
| InChIKey | CFVLLBWIPYZDIQ-UHFFFAOYSA-N |
| SMILES | C1N(C2=CC=CC=C2S1(=O)=O)C3=NC(=NC=C3Cl)Cl |
Computed by PubChem (NCBI)