CAS 1025265-09-1 is the registry number for 2-(2,2-dimethylpropanoyl)-3-((4-hydroxyphenyl)amino)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(2Z)-2-[(4-hydroxyanilino)methylidene]-4,4-dimethyl-3-oxopentanenitrile (CAS 1025265-09-1) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: (2Z)-2-[(4-hydroxyanilino)methylidene]-4,4-dimethyl-3-oxopentanenitrile. InChIKey: HNOFDPRTHKXNKP-KTKRTIGZSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (2Z)-2-[(4-hydroxyanilino)methylidene]-4,4-dimethyl-3-oxopentanenitrile |
| InChIKey | HNOFDPRTHKXNKP-KTKRTIGZSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C\NC1=CC=C(C=C1)O)/C#N |
Computed by PubChem (NCBI)