CAS 1025311-59-4 is the registry number for 4-(3-(3,4-dichlorophenyl)prop-2-enoyl)piperazinecarbaldehyde. Offered by: Biosynth. Available pack sizes: 250mg.
4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carbaldehyde (CAS 1025311-59-4) is a chemical compound with the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.2 g/mol. IUPAC name: 4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carbaldehyde. InChIKey: RGOHUWBULZWEDZ-DUXPYHPUSA-N.
| Molecular formula | C14H14Cl2N2O2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperazine-1-carbaldehyde |
| InChIKey | RGOHUWBULZWEDZ-DUXPYHPUSA-N |
| SMILES | C1CN(CCN1C=O)C(=O)/C=C/C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)