Products 13815-62-8

CAS 13815-62-8 is the registry number for 4-Chloro-benzoic Acid 1-(4-Methoxyphenyl)hydrazide Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.

Structural formula: {0} (CAS {1})

4-chloro-N-(4-methoxyphenyl)benzohydrazide;hydrochloride (CAS 13815-62-8) is a chemical compound with the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.2 g/mol. IUPAC name: 4-chloro-N-(4-methoxyphenyl)benzohydrazide;hydrochloride. InChIKey: ANYDSWOBDUWVHE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14Cl2N2O2
Molecular weight313.2 g/mol
IUPAC name4-chloro-N-(4-methoxyphenyl)benzohydrazide;hydrochloride
InChIKeyANYDSWOBDUWVHE-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N(C(=O)C2=CC=C(C=C2)Cl)N.Cl

Computed by PubChem (NCBI)