Products 102539-53-7
CAS 102539-53-7 appears in our catalog under these names: 4-Bromo-3-methyl-2,3-dihydro-1H-inden-1-one, 4-Bromo-3-methyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 4-Bromo-3-methyl-2,3-dihydro-1h-inden-1-one, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
4-bromo-3-methyl-2,3-dihydroinden-1-one (CAS 102539-53-7) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-3-methyl-2,3-dihydroinden-1-one. InChIKey: KRXGZWSZRJEHMX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | KRXGZWSZRJEHMX-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)