CAS 1025424-03-6 appears in our catalog under these names: 4-Methoxy-2-tosylisoindoline, 95%, 4–Methoxy–2–tosylisoindoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
4-methoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (CAS 1025424-03-6) is a chemical compound with the molecular formula C16H17NO3S and a molecular weight of 303.4 g/mol. IUPAC name: 4-methoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole. InChIKey: WUZKAVFZTPKEOZ-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 4-methoxy-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| InChIKey | WUZKAVFZTPKEOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3=C(C2)C(=CC=C3)OC |
Computed by PubChem (NCBI)