CAS 1374509-29-1 is the registry number for 7,7-Dimethyl-5-oxo-4-(2-thienyl)-1,4,5,6,7,8-hexahydroquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7,7-dimethyl-5-oxo-4-thiophen-2-yl-1,4,6,8-tetrahydroquinoline-2-carboxylic acid (CAS 1374509-29-1) is a chemical compound with the molecular formula C16H17NO3S and a molecular weight of 303.4 g/mol. IUPAC name: 7,7-dimethyl-5-oxo-4-thiophen-2-yl-1,4,6,8-tetrahydroquinoline-2-carboxylic acid. InChIKey: NUQWBCJZECCTIU-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 7,7-dimethyl-5-oxo-4-thiophen-2-yl-1,4,6,8-tetrahydroquinoline-2-carboxylic acid |
| InChIKey | NUQWBCJZECCTIU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(C=C(N2)C(=O)O)C3=CC=CS3)C(=O)C1)C |
Computed by PubChem (NCBI)