CAS 1025450-05-8 appears in our catalog under these names: 1-(Furan-2-carbonyl)piperidine-2-carboxylic acid, 95%, 95%, 1-(Furan-2-carbonyl)piperidine-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-(furan-2-carbonyl)piperidine-2-carboxylic acid (CAS 1025450-05-8) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 1-(furan-2-carbonyl)piperidine-2-carboxylic acid. InChIKey: ZNIKCBOCEIJMLK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1-(furan-2-carbonyl)piperidine-2-carboxylic acid |
| InChIKey | ZNIKCBOCEIJMLK-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)