CAS 1025530-23-7 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(phenylamino)-3-sulfanylprop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
(Z)-2-cyano-3-hydroxy-4,4-dimethyl-N-phenylpent-2-enethioamide (CAS 1025530-23-7) is a chemical compound with the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. IUPAC name: (Z)-2-cyano-3-hydroxy-4,4-dimethyl-N-phenylpent-2-enethioamide. InChIKey: OWAFSVKWXTZPPG-QXMHVHEDSA-N.
| Molecular formula | C14H16N2OS |
|---|---|
| Molecular weight | 260.36 g/mol |
| IUPAC name | (Z)-2-cyano-3-hydroxy-4,4-dimethyl-N-phenylpent-2-enethioamide |
| InChIKey | OWAFSVKWXTZPPG-QXMHVHEDSA-N |
| SMILES | CC(C)(C)/C(=C(\C#N)/C(=S)NC1=CC=CC=C1)/O |
Computed by PubChem (NCBI)