Products 1025562-35-9
CAS 1025562-35-9 is the registry number for 2-acetyl-3-((6-methoxy(3-pyridyl))amino)-N-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-3-hydroxy-2-[(6-methoxy-3-pyridinyl)iminomethyl]-N-phenylbut-2-enamide (CAS 1025562-35-9) is a chemical compound with the molecular formula C17H17N3O3 and a molecular weight of 311.33 g/mol. IUPAC name: (E)-3-hydroxy-2-[(6-methoxy-3-pyridinyl)iminomethyl]-N-phenylbut-2-enamide. InChIKey: OEQSVPVWPJWCQV-IZIPUBPZSA-N.
| Molecular formula | C17H17N3O3 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | (E)-3-hydroxy-2-[(6-methoxy-3-pyridinyl)iminomethyl]-N-phenylbut-2-enamide |
| InChIKey | OEQSVPVWPJWCQV-IZIPUBPZSA-N |
| SMILES | C/C(=C(/C=NC1=CN=C(C=C1)OC)\C(=O)NC2=CC=CC=C2)/O |
Computed by PubChem (NCBI)