Products 1025614-69-0
CAS 1025614-69-0 is the registry number for N-(((5-methylisoxazol-3-yl)amino)thioxomethyl)-3-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-N-[(5-methyl-1,2-oxazol-3-yl)carbamothioyl]-3-phenylprop-2-enamide (CAS 1025614-69-0) is a chemical compound with the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. IUPAC name: (E)-N-[(5-methyl-1,2-oxazol-3-yl)carbamothioyl]-3-phenylprop-2-enamide. InChIKey: WMZIWNXDEAFSSD-BQYQJAHWSA-N.
| Molecular formula | C14H13N3O2S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | (E)-N-[(5-methyl-1,2-oxazol-3-yl)carbamothioyl]-3-phenylprop-2-enamide |
| InChIKey | WMZIWNXDEAFSSD-BQYQJAHWSA-N |
| SMILES | CC1=CC(=NO1)NC(=S)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)