CAS 1186502-59-9 appears in our catalog under these names: 1-(Benzenesulfonyl)-2-methyl-1h-pyrrolo[2,3-b]pyridin-5-amine, 95%, 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo(2,3-b)pyridin-5-amine, 97%, 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin-5-amine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
1-(benzenesulfonyl)-2-methylpyrrolo[2,3-b]pyridin-5-amine (CAS 1186502-59-9) is a chemical compound with the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-methylpyrrolo[2,3-b]pyridin-5-amine. InChIKey: VVFKELIDMAIOMX-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2S |
|---|---|
| Molecular weight | 287.34 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-methylpyrrolo[2,3-b]pyridin-5-amine |
| InChIKey | VVFKELIDMAIOMX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=CN=C2N1S(=O)(=O)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)