CAS 1025669-17-3 is the registry number for 2-(2-(3H-2,3,5-triazolyl)-2-aza-1-phenylvinyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[C-phenyl-N-(1H-1,2,4-triazol-5-yl)carbonimidoyl]indene-1,3-dione (CAS 1025669-17-3) is a chemical compound with the molecular formula C18H12N4O2 and a molecular weight of 316.3 g/mol. IUPAC name: 2-[C-phenyl-N-(1H-1,2,4-triazol-5-yl)carbonimidoyl]indene-1,3-dione. InChIKey: WGAUBJOXZRVWTR-UHFFFAOYSA-N.
| Molecular formula | C18H12N4O2 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 2-[C-phenyl-N-(1H-1,2,4-triazol-5-yl)carbonimidoyl]indene-1,3-dione |
| InChIKey | WGAUBJOXZRVWTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NC2=NC=NN2)C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)