CAS 351857-78-8 is the registry number for 2-(((4-(1,2,4-triazolyl)phenyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-[[4-(1,2,4-triazol-1-yl)phenyl]iminomethyl]inden-1-one (CAS 351857-78-8) is a chemical compound with the molecular formula C18H12N4O2 and a molecular weight of 316.3 g/mol. IUPAC name: 3-hydroxy-2-[[4-(1,2,4-triazol-1-yl)phenyl]iminomethyl]inden-1-one. InChIKey: CLCXILDVOATZAR-UHFFFAOYSA-N.
| Molecular formula | C18H12N4O2 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 3-hydroxy-2-[[4-(1,2,4-triazol-1-yl)phenyl]iminomethyl]inden-1-one |
| InChIKey | CLCXILDVOATZAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=CC=C(C=C3)N4C=NC=N4)O |
Computed by PubChem (NCBI)