CAS 1025677-86-4 is the registry number for N-(2,4-dichlorophenyl)-2-nitrilo-3-(2-pyridylamino)prop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-(pyridin-2-ylamino)prop-2-enamide (CAS 1025677-86-4) is a chemical compound with the molecular formula C15H10Cl2N4O and a molecular weight of 333.2 g/mol. IUPAC name: (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-(pyridin-2-ylamino)prop-2-enamide. InChIKey: UWQFARKYMFGBJI-KTKRTIGZSA-N.
| Molecular formula | C15H10Cl2N4O |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-(pyridin-2-ylamino)prop-2-enamide |
| InChIKey | UWQFARKYMFGBJI-KTKRTIGZSA-N |
| SMILES | C1=CC=NC(=C1)N/C=C(/C#N)\C(=O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)