Products 2094176-41-5
CAS 2094176-41-5 is the registry number for 4-Amino-3,5-dichloro-N-(phthalazin-5-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3,5-dichloro-N-phthalazin-5-ylbenzamide (CAS 2094176-41-5) is a chemical compound with the molecular formula C15H10Cl2N4O and a molecular weight of 333.2 g/mol. IUPAC name: 4-amino-3,5-dichloro-N-phthalazin-5-ylbenzamide. InChIKey: GVLARHKLXKQKRG-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N4O |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 4-amino-3,5-dichloro-N-phthalazin-5-ylbenzamide |
| InChIKey | GVLARHKLXKQKRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NC=C2C(=C1)NC(=O)C3=CC(=C(C(=C3)Cl)N)Cl |
Computed by PubChem (NCBI)