CAS 1025716-99-7 is the registry number for Nilotinib Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid (CAS 1025716-99-7) is a chemical compound with the molecular formula C10H14N4O5 and a molecular weight of 270.24 g/mol. IUPAC name: methyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid. InChIKey: SFHRCNFZNRMPOT-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | methyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid |
| InChIKey | SFHRCNFZNRMPOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)