Products 1025716-99-7

CAS 1025716-99-7 is the registry number for Nilotinib Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid (CAS 1025716-99-7) is a chemical compound with the molecular formula C10H14N4O5 and a molecular weight of 270.24 g/mol. IUPAC name: methyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid. InChIKey: SFHRCNFZNRMPOT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N4O5
Molecular weight270.24 g/mol
IUPAC namemethyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid
InChIKeySFHRCNFZNRMPOT-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)OC)N=C(N)N.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)