CAS 20223-80-7 appears in our catalog under these names: H-beta-Asp-His-OH, H–Asp(His–OH)–OH, H-Asp(His-OH)-OH, Beta-Asp-His. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 1g, 250mg, 50mg, 25mg, 100mg, Get quote.
(2S)-2-amino-4-[[(1S)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-4-oxobutanoic acid (CAS 20223-80-7) is a chemical compound with the molecular formula C10H14N4O5 and a molecular weight of 270.24 g/mol. IUPAC name: (2S)-2-amino-4-[[(1S)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-4-oxobutanoic acid. InChIKey: KABYBYFUSGXITA-BQBZGAKWSA-N.
| Molecular formula | C10H14N4O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | (2S)-2-amino-4-[[(1S)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-4-oxobutanoic acid |
| InChIKey | KABYBYFUSGXITA-BQBZGAKWSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)