CAS 102579-59-9 appears in our catalog under these names: Aztreonam Impurity 5, Aztreonam impurity D, Aztreonam USP Impurity D. Offered by: Hubei YoungXin, Biosynth, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (CAS 102579-59-9) is a chemical compound with the molecular formula C13H17N5O5S and a molecular weight of 355.37 g/mol. IUPAC name: 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid. InChIKey: XSBOMZYBOQIGCO-VQSOLXJISA-N.
| Molecular formula | C13H17N5O5S |
|---|---|
| Molecular weight | 355.37 g/mol |
| IUPAC name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| InChIKey | XSBOMZYBOQIGCO-VQSOLXJISA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1)NC(=O)/C(=N\OC(C)(C)C(=O)O)/C2=CSC(=N2)N |
Computed by PubChem (NCBI)