CAS 126092-30-6 is the registry number for 8-Allylthioguanosine. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 100 mg, 1 mg, 50 mg.
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-prop-2-enylsulfanyl-1H-purin-6-one (CAS 126092-30-6) is a chemical compound with the molecular formula C13H17N5O5S and a molecular weight of 355.37 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-prop-2-enylsulfanyl-1H-purin-6-one. InChIKey: GUGINDRESZHQCY-IOSLPCCCSA-N.
| Molecular formula | C13H17N5O5S |
|---|---|
| Molecular weight | 355.37 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-prop-2-enylsulfanyl-1H-purin-6-one |
| InChIKey | GUGINDRESZHQCY-IOSLPCCCSA-N |
| SMILES | C=CCSC1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)