CAS 10259-19-5 appears in our catalog under these names: 2-Methyl-d3-pyridine, >95% (GC), 2-Methyl-d3-pyridine, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 50mg, 5mg, 1g, 0,5g.
2-(trideuteriomethyl)pyridine (CAS 10259-19-5) is a chemical compound with the molecular formula C6H7N and a molecular weight of 96.14 g/mol. IUPAC name: 2-(trideuteriomethyl)pyridine. InChIKey: BSKHPKMHTQYZBB-FIBGUPNXSA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 96.14 g/mol |
| IUPAC name | 2-(trideuteriomethyl)pyridine |
| InChIKey | BSKHPKMHTQYZBB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC=N1 |
Computed by PubChem (NCBI)