CAS 93951-93-0 appears in our catalog under these names: 2-Picoline-d7, >95% (HPLC), 2-Methylpyridine-d7, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 1g, 250mg, 0,5g.
2,3,4,5-tetradeuterio-6-(trideuteriomethyl)pyridine (CAS 93951-93-0) is a chemical compound with the molecular formula C6H7N and a molecular weight of 100.17 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)pyridine. InChIKey: BSKHPKMHTQYZBB-AAYPNNLASA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 100.17 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)pyridine |
| InChIKey | BSKHPKMHTQYZBB-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)