CAS 1025927-65-4 appears in our catalog under these names: 5-(2-Fluorophenyl)thiazol-2-amine, 95%, 95%, 5-(2-Fluorophenyl)-1,3-thiazol-2-amine, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
5-(2-fluorophenyl)-1,3-thiazol-2-amine (CAS 1025927-65-4) is a chemical compound with the molecular formula C9H7FN2S and a molecular weight of 194.23 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,3-thiazol-2-amine. InChIKey: VRTBWNUGNJHAEX-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2S |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | VRTBWNUGNJHAEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(S2)N)F |
Computed by PubChem (NCBI)