CAS 774-50-5 is the registry number for 5-(4-Fluorophenyl)thiazol-2-amine, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
5-(4-fluorophenyl)-1,3-thiazol-2-amine (CAS 774-50-5) is a chemical compound with the molecular formula C9H7FN2S and a molecular weight of 194.23 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,3-thiazol-2-amine. InChIKey: ADOSTLZJKSBUSD-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2S |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | ADOSTLZJKSBUSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(S2)N)F |
Computed by PubChem (NCBI)