Products 102596-84-9

CAS 102596-84-9 is the registry number for 2-((N,N-Dibenzylamino)methyl)cyclohexanone Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 0,5mg.

Structural formula: {0} (CAS {1})

2-[(dibenzylamino)methyl]cyclohexan-1-one;hydrochloride (CAS 102596-84-9) is a chemical compound with the molecular formula C21H26ClNO and a molecular weight of 343.9 g/mol. IUPAC name: 2-[(dibenzylamino)methyl]cyclohexan-1-one;hydrochloride. InChIKey: VTLHJZKKRMZUPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26ClNO
Molecular weight343.9 g/mol
IUPAC name2-[(dibenzylamino)methyl]cyclohexan-1-one;hydrochloride
InChIKeyVTLHJZKKRMZUPQ-UHFFFAOYSA-N
SMILESC1CCC(=O)C(C1)CN(CC2=CC=CC=C2)CC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)