CAS 15686-51-8 appears in our catalog under these names: Clemastine, 99+%, Clemastine/ 99.83% (existing batch purity), (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine, 98%, 98%, Clemastine, 98.41%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 10mg, 25mg, 50mg, 100mg, 5mg, 50 mg, 10 mg.
(2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine (CAS 15686-51-8) is a chemical compound with the molecular formula C21H26ClNO and a molecular weight of 343.9 g/mol. IUPAC name: (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine. InChIKey: YNNUSGIPVFPVBX-NHCUHLMSSA-N.
| Molecular formula | C21H26ClNO |
|---|---|
| Molecular weight | 343.9 g/mol |
| IUPAC name | (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine |
| InChIKey | YNNUSGIPVFPVBX-NHCUHLMSSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[C@H]3CCCN3C |
Computed by PubChem (NCBI)