CAS 1026047-17-5 is the registry number for 1-(2-Methyl-1,5-naphthyridin-4-yl)-3-(2-methylbenzo[d]oxazol-6-yl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2-methyl-1,3-benzoxazol-6-yl)-3-(2-methyl-1,5-naphthyridin-4-yl)urea (CAS 1026047-17-5) is a chemical compound with the molecular formula C18H15N5O2 and a molecular weight of 333.3 g/mol. IUPAC name: 1-(2-methyl-1,3-benzoxazol-6-yl)-3-(2-methyl-1,5-naphthyridin-4-yl)urea. InChIKey: BGGKKLOCMASTLG-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O2 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 1-(2-methyl-1,3-benzoxazol-6-yl)-3-(2-methyl-1,5-naphthyridin-4-yl)urea |
| InChIKey | BGGKKLOCMASTLG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=N1)C=CC=N2)NC(=O)NC3=CC4=C(C=C3)N=C(O4)C |
Computed by PubChem (NCBI)