CAS 1369497-19-7 is the registry number for 1-(2-Ethylbenzo[d]oxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2-ethyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea (CAS 1369497-19-7) is a chemical compound with the molecular formula C18H15N5O2 and a molecular weight of 333.3 g/mol. IUPAC name: 1-(2-ethyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea. InChIKey: CEIYHUGYEGJQNX-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O2 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 1-(2-ethyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea |
| InChIKey | CEIYHUGYEGJQNX-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(O1)C=C(C=C2)NC(=O)NC3=C4C(=NC=C3)C=CC=N4 |
Computed by PubChem (NCBI)