CAS 1026287-65-9 appears in our catalog under these names: 2-Chloro-n-(thiophen-2-ylmethyl)quinazolin-4-amine, 95%, 2–Chloro–N–(thiophen–2–ylmethyl)quinazolin–4–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g.
2-chloro-N-(thiophen-2-ylmethyl)quinazolin-4-amine (CAS 1026287-65-9) is a chemical compound with the molecular formula C13H10ClN3S and a molecular weight of 275.76 g/mol. IUPAC name: 2-chloro-N-(thiophen-2-ylmethyl)quinazolin-4-amine. InChIKey: CVAMKMNWQVMRDG-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3S |
|---|---|
| Molecular weight | 275.76 g/mol |
| IUPAC name | 2-chloro-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
| InChIKey | CVAMKMNWQVMRDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Cl)NCC3=CC=CS3 |
Computed by PubChem (NCBI)