Products 930875-92-6
CAS 930875-92-6 is the registry number for N-(2-Chlorobenzyl)thieno[3,2-d]pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-chlorophenyl)methyl]thieno[3,2-d]pyrimidin-4-amine (CAS 930875-92-6) is a chemical compound with the molecular formula C13H10ClN3S and a molecular weight of 275.76 g/mol. IUPAC name: N-[(2-chlorophenyl)methyl]thieno[3,2-d]pyrimidin-4-amine. InChIKey: VTICZAXNHXNUDO-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3S |
|---|---|
| Molecular weight | 275.76 g/mol |
| IUPAC name | N-[(2-chlorophenyl)methyl]thieno[3,2-d]pyrimidin-4-amine |
| InChIKey | VTICZAXNHXNUDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC=NC3=C2SC=C3)Cl |
Computed by PubChem (NCBI)