Products 1026299-50-2
CAS 1026299-50-2 is the registry number for (2-morpholin-4-ylphenyl)((2-nitrophenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-morpholin-4-ylphenyl)-2-nitrobenzenesulfonamide (CAS 1026299-50-2) is a chemical compound with the molecular formula C16H17N3O5S and a molecular weight of 363.4 g/mol. IUPAC name: N-(2-morpholin-4-ylphenyl)-2-nitrobenzenesulfonamide. InChIKey: VRWGUCDNUGRBTA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | N-(2-morpholin-4-ylphenyl)-2-nitrobenzenesulfonamide |
| InChIKey | VRWGUCDNUGRBTA-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CC=C2NS(=O)(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)