Products 79962-91-7
CAS 79962-91-7 is the registry number for Cefadroxil Impurity C. Offered by: TRC. Available pack sizes: 5mg.
2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid (CAS 79962-91-7) is a chemical compound with the molecular formula C16H17N3O5S and a molecular weight of 363.4 g/mol. IUPAC name: 2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid. InChIKey: KEYBHTOVFWHAHZ-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
| InChIKey | KEYBHTOVFWHAHZ-UHFFFAOYSA-N |
| SMILES | CC1CSC(N=C1C(=O)O)C2C(=O)NC(C(=O)N2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Cefadroxil Impurity C