CAS 1026437-82-0 appears in our catalog under these names: 3-Bromo-2-chloro-7-nitroquinoline, 95%, 95%, 3-Bromo-2-chloro-7-nitroquinoline, 95%, 3-Bromo-2-chloro-7-nitroquinoline 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-2-chloro-7-nitroquinoline (CAS 1026437-82-0) is a chemical compound with the molecular formula C9H4BrClN2O2 and a molecular weight of 287.50 g/mol. IUPAC name: 3-bromo-2-chloro-7-nitroquinoline. InChIKey: AAMUURCEDXGFGI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClN2O2 |
|---|---|
| Molecular weight | 287.50 g/mol |
| IUPAC name | 3-bromo-2-chloro-7-nitroquinoline |
| InChIKey | AAMUURCEDXGFGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC(=C(C=C21)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)