Products 1369199-81-4
CAS 1369199-81-4 is the registry number for 4-Bromo-1-chloro-6-nitro-isoquinoline. Offered by: TRC. Available pack sizes: 100mg.
4-bromo-1-chloro-6-nitroisoquinoline (CAS 1369199-81-4) is a chemical compound with the molecular formula C9H4BrClN2O2 and a molecular weight of 287.50 g/mol. IUPAC name: 4-bromo-1-chloro-6-nitroisoquinoline. InChIKey: XITPXUHGYLYZLX-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClN2O2 |
|---|---|
| Molecular weight | 287.50 g/mol |
| IUPAC name | 4-bromo-1-chloro-6-nitroisoquinoline |
| InChIKey | XITPXUHGYLYZLX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN=C2Cl)Br |
Computed by PubChem (NCBI)