CAS 102692-36-4 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(p-tolyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4-methylphenyl)-1-(4-phenylphenyl)prop-2-en-1-one (CAS 102692-36-4) is a chemical compound with the molecular formula C22H18O and a molecular weight of 298.4 g/mol. IUPAC name: (E)-3-(4-methylphenyl)-1-(4-phenylphenyl)prop-2-en-1-one. InChIKey: JTSGWWQKGVNALD-LFIBNONCSA-N.
| Molecular formula | C22H18O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (E)-3-(4-methylphenyl)-1-(4-phenylphenyl)prop-2-en-1-one |
| InChIKey | JTSGWWQKGVNALD-LFIBNONCSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)